About 2-amino-N-butyl-4,5-bis(4-chlorophenyl)thiophene-3-carboxamide
2-amino-N-butyl-4,5-bis(4-chlorophenyl)thiophene-3-carboxamide (PubChem CID 71657940) has the molecular formula C21H20Cl2N2OS
and a molecular weight of 419.38 g/mol. Its IUPAC name is 2-amino-N-butyl-4,5-bis(4-chlorophenyl)thiophene-3-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N-butyl-4,5-bis(4-chlorophenyl)thiophene-3-carboxamide |
| PubChem CID | 71657940 |
| Molecular Formula | C21H20Cl2N2OS |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 2-amino-N-butyl-4,5-bis(4-chlorophenyl)thiophene-3-carboxamide |
| SMILES | CCCCNC(=O)c1c(N)sc(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20Cl2N2OS/c1-2-3-12-25-21(26)18-17(13-4-8-15(22)9-5-13)19(27-20(18)24)14-6-10-16(23)11-7-14/h4-11H,2-3,12,24H2,1H3,(H,25,26) |
| InChIKey | NYXPBKAJSGDSJN-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-butyl-4,5-bis(4-chlorophenyl)thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-butyl-4,5-bis(4-chlorophenyl)thiophene-3-carboxamide?
The IUPAC name of 2-amino-N-butyl-4,5-bis(4-chlorophenyl)thiophene-3-carboxamide (CID 71657940) is 2-amino-N-butyl-4,5-bis(4-chlorophenyl)thiophene-3-carboxamide.
What is the SMILES notation for 2-amino-N-butyl-4,5-bis(4-chlorophenyl)thiophene-3-carboxamide?
The canonical SMILES for 2-amino-N-butyl-4,5-bis(4-chlorophenyl)thiophene-3-carboxamide is CCCCNC(=O)c1c(N)sc(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1.
What is the InChIKey of 2-amino-N-butyl-4,5-bis(4-chlorophenyl)thiophene-3-carboxamide?
The InChIKey is NYXPBKAJSGDSJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20Cl2N2OS/c1-2-3-12-25-21(26)18-17(13-4-8-15(22)9-5-13)19(27-20(18)24)14-6-10-16(23)11-7-14/h4-11H,2-3,12,24H2,1H3,(H,25,26).
What are the key properties of 2-amino-N-butyl-4,5-bis(4-chlorophenyl)thiophene-3-carboxamide?
2-amino-N-butyl-4,5-bis(4-chlorophenyl)thiophene-3-carboxamide has a molecular weight of 419.38 g/mol, XLogP of 6.50, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-butyl-4,5-bis(4-chlorophenyl)thiophene-3-carboxamide is sourced from PubChem (CID 71657940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).