About [4-[(E)-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl] 2-fluorobenzoate
[4-[(E)-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl] 2-fluorobenzoate (PubChem CID 7165796) has the molecular formula C24H18FNO3
and a molecular weight of 387.41 g/mol. Its IUPAC name is [4-[(E)-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl] 2-fluorobenzoate.
Molecular Properties
| Compound Name | [4-[(E)-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl] 2-fluorobenzoate |
| PubChem CID | 7165796 |
| Molecular Formula | C24H18FNO3 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | [4-[(E)-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl] 2-fluorobenzoate |
| SMILES | O=C(Oc1ccc(/C=C/C(=O)N2CCc3ccccc32)cc1)c1ccccc1F |
| InChI | InChI=1S/C24H18FNO3/c25-21-7-3-2-6-20(21)24(28)29-19-12-9-17(10-13-19)11-14-23(27)26-16-15-18-5-1-4-8-22(18)26/h1-14H,15-16H2/b14-11+ |
| InChIKey | XWFMUQUXVSJCAO-SDNWHVSQSA-N |
| XLogP | 4.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(E)-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl] 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E)-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl] 2-fluorobenzoate?
The IUPAC name of [4-[(E)-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl] 2-fluorobenzoate (CID 7165796) is [4-[(E)-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl] 2-fluorobenzoate.
What is the SMILES notation for [4-[(E)-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl] 2-fluorobenzoate?
The canonical SMILES for [4-[(E)-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl] 2-fluorobenzoate is O=C(Oc1ccc(/C=C/C(=O)N2CCc3ccccc32)cc1)c1ccccc1F.
What is the InChIKey of [4-[(E)-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl] 2-fluorobenzoate?
The InChIKey is XWFMUQUXVSJCAO-SDNWHVSQSA-N. The full InChI is InChI=1S/C24H18FNO3/c25-21-7-3-2-6-20(21)24(28)29-19-12-9-17(10-13-19)11-14-23(27)26-16-15-18-5-1-4-8-22(18)26/h1-14H,15-16H2/b14-11+.
What are the key properties of [4-[(E)-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl] 2-fluorobenzoate?
[4-[(E)-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl] 2-fluorobenzoate has a molecular weight of 387.41 g/mol, XLogP of 4.65, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E)-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl] 2-fluorobenzoate is sourced from PubChem (CID 7165796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).