C26H24N2O4 — CID 71657988
(1S,2R,3S,4S,6S)-6-hydroxy-1'-methyl-3-nitro-2,4-diphenylspiro[cyclohexane-1,3'-indole]-2'-one (PubChem CID 71657988) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is (1S,2R,3S,4S,6S)-6-hydroxy-1'-methyl-3-nitro-2,4-diphenylspiro[cyclohexane-1,3'-indole]-2'-one.
| Compound Name | (1S,2R,3S,4S,6S)-6-hydroxy-1'-methyl-3-nitro-2,4-diphenylspiro[cyclohexane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 71657988 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (1S,2R,3S,4S,6S)-6-hydroxy-1'-methyl-3-nitro-2,4-diphenylspiro[cyclohexane-1,3'-indole]-2'-one |
| SMILES | CN1C(=O)[C@@]2(c3ccccc31)[C@@H](O)C[C@@H](c1ccccc1)[C@H]([N+](=O)[O-])[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C26H24N2O4/c1-27-21-15-9-8-14-20(21)26(25(27)30)22(29)16-19(17-10-4-2-5-11-17)24(28(31)32)23(26)18-12-6-3-7-13-18/h2-15,19,22-24,29H,16H2,1H3/t19-,22-,23-,24-,26-/m0/s1 |
| InChIKey | FBJIGSGKNAXMOZ-VNJQJXRGSA-N |
| XLogP | 3.88 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|