C25H44O4 — CID 71658007
(17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione (PubChem CID 71658007) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione.
| Compound Name | (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione |
|---|---|
| PubChem CID | 71658007 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione |
| SMILES | O=C1CCCCCCCC/C=C\CCCCCCCCC(=O)OCCCCCO1 |
| InChI | InChI=1S/C25H44O4/c26-24-20-16-13-11-9-7-5-3-1-2-4-6-8-10-12-14-17-21-25(27)29-23-19-15-18-22-28-24/h1-2H,3-23H2/b2-1- |
| InChIKey | OTVQKEABASTROT-UPHRSURJSA-N |
| XLogP | 7.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|