About (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione
(17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione (PubChem CID 71658007) has the molecular formula C25H44O4
and a molecular weight of 408.62 g/mol. Its IUPAC name is (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione.
Molecular Properties
| Compound Name | (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione |
| PubChem CID | 71658007 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione |
| SMILES | O=C1CCCCCCCC/C=C\CCCCCCCCC(=O)OCCCCCO1 |
| InChI | InChI=1S/C25H44O4/c26-24-20-16-13-11-9-7-5-3-1-2-4-6-8-10-12-14-17-21-25(27)29-23-19-15-18-22-28-24/h1-2H,3-23H2/b2-1- |
| InChIKey | OTVQKEABASTROT-UPHRSURJSA-N |
| XLogP | 7.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione?
The IUPAC name of (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione (CID 71658007) is (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione.
What is the SMILES notation for (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione?
The canonical SMILES for (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione is O=C1CCCCCCCC/C=C\CCCCCCCCC(=O)OCCCCCO1.
What is the InChIKey of (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione?
The InChIKey is OTVQKEABASTROT-UPHRSURJSA-N. The full InChI is InChI=1S/C25H44O4/c26-24-20-16-13-11-9-7-5-3-1-2-4-6-8-10-12-14-17-21-25(27)29-23-19-15-18-22-28-24/h1-2H,3-23H2/b2-1-.
What are the key properties of (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione?
(17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione has a molecular weight of 408.62 g/mol, XLogP of 7.05, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (17E)-1,7-dioxacycloheptacos-17-ene-8,27-dione is sourced from PubChem (CID 71658007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).