C35H41NO6S2 — CID 71658018
1-[(3R,6S)-4-benzoyl-1-(4-methylphenyl)sulfonyl-6-(2-methylsulfonylethyl)-5-phenyl-3,6-dihydro-2H-pyridin-3-yl]heptan-2-one (PubChem CID 71658018) has the molecular formula C35H41NO6S2 and a molecular weight of 635.85 g/mol. Its IUPAC name is 1-[(3R,6S)-4-benzoyl-1-(4-methylphenyl)sulfonyl-6-(2-methylsulfonylethyl)-5-phenyl-3,6-dihydro-2H-pyridin-3-yl]heptan-2-one.
| Compound Name | 1-[(3R,6S)-4-benzoyl-1-(4-methylphenyl)sulfonyl-6-(2-methylsulfonylethyl)-5-phenyl-3,6-dihydro-2H-pyridin-3-yl]heptan-2-one |
|---|---|
| PubChem CID | 71658018 |
| Molecular Formula | C35H41NO6S2 |
| Molecular Weight | 635.85 g/mol |
| Exact Mass | 635.24 |
| IUPAC Name | 1-[(3R,6S)-4-benzoyl-1-(4-methylphenyl)sulfonyl-6-(2-methylsulfonylethyl)-5-phenyl-3,6-dihydro-2H-pyridin-3-yl]heptan-2-one |
| SMILES | CCCCCC(=O)C[C@H]1CN(S(=O)(=O)c2ccc(C)cc2)[C@@H](CCS(C)(=O)=O)C(c2ccccc2)=C1C(=O)c1ccccc1 |
| InChI | InChI=1S/C35H41NO6S2/c1-4-5-8-17-30(37)24-29-25-36(44(41,42)31-20-18-26(2)19-21-31)32(22-23-43(3,39)40)33(27-13-9-6-10-14-27)34(29)35(38)28-15-11-7-12-16-28/h6-7,9-16,18-21,29,32H,4-5,8,17,22-25H2,1-3H3/t29-,32-/m0/s1 |
| InChIKey | VBIMAYVGAUPSMP-NYDCQLBNSA-N |
| XLogP | 6.30 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.85 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|