About 2-amino-4,5-bis(4-chlorophenyl)-N-[(4-methoxyphenyl)methyl]thiophene-3-carboxamide
2-amino-4,5-bis(4-chlorophenyl)-N-[(4-methoxyphenyl)methyl]thiophene-3-carboxamide (PubChem CID 71658068) has the molecular formula C25H20Cl2N2O2S
and a molecular weight of 483.42 g/mol. Its IUPAC name is 2-amino-4,5-bis(4-chlorophenyl)-N-[(4-methoxyphenyl)methyl]thiophene-3-carboxamide.
Molecular Properties
| Compound Name | 2-amino-4,5-bis(4-chlorophenyl)-N-[(4-methoxyphenyl)methyl]thiophene-3-carboxamide |
| PubChem CID | 71658068 |
| Molecular Formula | C25H20Cl2N2O2S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 2-amino-4,5-bis(4-chlorophenyl)-N-[(4-methoxyphenyl)methyl]thiophene-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2c(N)sc(-c3ccc(Cl)cc3)c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H20Cl2N2O2S/c1-31-20-12-2-15(3-13-20)14-29-25(30)22-21(16-4-8-18(26)9-5-16)23(32-24(22)28)17-6-10-19(27)11-7-17/h2-13H,14,28H2,1H3,(H,29,30) |
| InChIKey | IGFMOKSIQZBYBO-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,5-bis(4-chlorophenyl)-N-[(4-methoxyphenyl)methyl]thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-bis(4-chlorophenyl)-N-[(4-methoxyphenyl)methyl]thiophene-3-carboxamide?
The IUPAC name of 2-amino-4,5-bis(4-chlorophenyl)-N-[(4-methoxyphenyl)methyl]thiophene-3-carboxamide (CID 71658068) is 2-amino-4,5-bis(4-chlorophenyl)-N-[(4-methoxyphenyl)methyl]thiophene-3-carboxamide.
What is the SMILES notation for 2-amino-4,5-bis(4-chlorophenyl)-N-[(4-methoxyphenyl)methyl]thiophene-3-carboxamide?
The canonical SMILES for 2-amino-4,5-bis(4-chlorophenyl)-N-[(4-methoxyphenyl)methyl]thiophene-3-carboxamide is COc1ccc(CNC(=O)c2c(N)sc(-c3ccc(Cl)cc3)c2-c2ccc(Cl)cc2)cc1.
What is the InChIKey of 2-amino-4,5-bis(4-chlorophenyl)-N-[(4-methoxyphenyl)methyl]thiophene-3-carboxamide?
The InChIKey is IGFMOKSIQZBYBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20Cl2N2O2S/c1-31-20-12-2-15(3-13-20)14-29-25(30)22-21(16-4-8-18(26)9-5-16)23(32-24(22)28)17-6-10-19(27)11-7-17/h2-13H,14,28H2,1H3,(H,29,30).
What are the key properties of 2-amino-4,5-bis(4-chlorophenyl)-N-[(4-methoxyphenyl)methyl]thiophene-3-carboxamide?
2-amino-4,5-bis(4-chlorophenyl)-N-[(4-methoxyphenyl)methyl]thiophene-3-carboxamide has a molecular weight of 483.42 g/mol, XLogP of 6.91, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-bis(4-chlorophenyl)-N-[(4-methoxyphenyl)methyl]thiophene-3-carboxamide is sourced from PubChem (CID 71658068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).