C18H26O4 — CID 71658175
methyl (1R,2S,3S,4S,5S)-2-hexyl-4-propanoyl-8-oxatricyclo[3.2.1.02,4]oct-6-ene-3-carboxylate (PubChem CID 71658175) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is methyl (1R,2S,3S,4S,5S)-2-hexyl-4-propanoyl-8-oxatricyclo[3.2.1.02,4]oct-6-ene-3-carboxylate.
| Compound Name | methyl (1R,2S,3S,4S,5S)-2-hexyl-4-propanoyl-8-oxatricyclo[3.2.1.02,4]oct-6-ene-3-carboxylate |
|---|---|
| PubChem CID | 71658175 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | methyl (1R,2S,3S,4S,5S)-2-hexyl-4-propanoyl-8-oxatricyclo[3.2.1.02,4]oct-6-ene-3-carboxylate |
| SMILES | CCCCCC[C@@]12[C@H]3C=C[C@H](O3)[C@]1(C(=O)CC)[C@H]2C(=O)OC |
| InChI | InChI=1S/C18H26O4/c1-4-6-7-8-11-17-13-9-10-14(22-13)18(17,12(19)5-2)15(17)16(20)21-3/h9-10,13-15H,4-8,11H2,1-3H3/t13-,14+,15+,17+,18-/m1/s1 |
| InChIKey | ACUHAYUAUZRMGR-CFVWQIKISA-N |
| XLogP | 3.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|