About 3,6-bis(4-fluorophenyl)-N,N-dimethylpyridin-2-amine
3,6-bis(4-fluorophenyl)-N,N-dimethylpyridin-2-amine (PubChem CID 71658278) has the molecular formula C19H16F2N2
and a molecular weight of 310.35 g/mol. Its IUPAC name is 3,6-bis(4-fluorophenyl)-N,N-dimethylpyridin-2-amine.
Molecular Properties
| Compound Name | 3,6-bis(4-fluorophenyl)-N,N-dimethylpyridin-2-amine |
| PubChem CID | 71658278 |
| Molecular Formula | C19H16F2N2 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 3,6-bis(4-fluorophenyl)-N,N-dimethylpyridin-2-amine |
| SMILES | CN(C)c1nc(-c2ccc(F)cc2)ccc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16F2N2/c1-23(2)19-17(13-3-7-15(20)8-4-13)11-12-18(22-19)14-5-9-16(21)10-6-14/h3-12H,1-2H3 |
| InChIKey | NCHWMUYLXJYHMS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-bis(4-fluorophenyl)-N,N-dimethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-bis(4-fluorophenyl)-N,N-dimethylpyridin-2-amine?
The IUPAC name of 3,6-bis(4-fluorophenyl)-N,N-dimethylpyridin-2-amine (CID 71658278) is 3,6-bis(4-fluorophenyl)-N,N-dimethylpyridin-2-amine.
What is the SMILES notation for 3,6-bis(4-fluorophenyl)-N,N-dimethylpyridin-2-amine?
The canonical SMILES for 3,6-bis(4-fluorophenyl)-N,N-dimethylpyridin-2-amine is CN(C)c1nc(-c2ccc(F)cc2)ccc1-c1ccc(F)cc1.
What is the InChIKey of 3,6-bis(4-fluorophenyl)-N,N-dimethylpyridin-2-amine?
The InChIKey is NCHWMUYLXJYHMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F2N2/c1-23(2)19-17(13-3-7-15(20)8-4-13)11-12-18(22-19)14-5-9-16(21)10-6-14/h3-12H,1-2H3.
What are the key properties of 3,6-bis(4-fluorophenyl)-N,N-dimethylpyridin-2-amine?
3,6-bis(4-fluorophenyl)-N,N-dimethylpyridin-2-amine has a molecular weight of 310.35 g/mol, XLogP of 4.76, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-bis(4-fluorophenyl)-N,N-dimethylpyridin-2-amine is sourced from PubChem (CID 71658278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).