C36H36O2S2 — CID 71658320
2,7-dibutyl-1,6-bis(4-methoxyphenyl)-[1]benzothiolo[7,6-g][1]benzothiole (PubChem CID 71658320) has the molecular formula C36H36O2S2 and a molecular weight of 564.82 g/mol. Its IUPAC name is 2,7-dibutyl-1,6-bis(4-methoxyphenyl)-[1]benzothiolo[7,6-g][1]benzothiole.
| Compound Name | 2,7-dibutyl-1,6-bis(4-methoxyphenyl)-[1]benzothiolo[7,6-g][1]benzothiole |
|---|---|
| PubChem CID | 71658320 |
| Molecular Formula | C36H36O2S2 |
| Molecular Weight | 564.82 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 2,7-dibutyl-1,6-bis(4-methoxyphenyl)-[1]benzothiolo[7,6-g][1]benzothiole |
| SMILES | CCCCc1sc2c(ccc3c2ccc2c(-c4ccc(OC)cc4)c(CCCC)sc23)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C36H36O2S2/c1-5-7-9-31-33(23-11-15-25(37-3)16-12-23)29-21-19-28-27(35(29)39-31)20-22-30-34(24-13-17-26(38-4)18-14-24)32(10-8-6-2)40-36(28)30/h11-22H,5-10H2,1-4H3 |
| InChIKey | OPVPPJFKYZRTEX-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.82 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |