C16H24N2O — CID 71658691
N-(2,4,4-trimethylpentan-2-yl)-4H-1,3-benzoxazin-2-amine (PubChem CID 71658691) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is N-(2,4,4-trimethylpentan-2-yl)-4H-1,3-benzoxazin-2-amine.
| Compound Name | N-(2,4,4-trimethylpentan-2-yl)-4H-1,3-benzoxazin-2-amine |
|---|---|
| PubChem CID | 71658691 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-(2,4,4-trimethylpentan-2-yl)-4H-1,3-benzoxazin-2-amine |
| SMILES | CC(C)(C)CC(C)(C)NC1=NCc2ccccc2O1 |
| InChI | InChI=1S/C16H24N2O/c1-15(2,3)11-16(4,5)18-14-17-10-12-8-6-7-9-13(12)19-14/h6-9H,10-11H2,1-5H3,(H,17,18) |
| InChIKey | KDLABEDGWJSJLU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |