About 4-tert-butyl-1,1-bis(decylperoxy)cyclohexane
4-tert-butyl-1,1-bis(decylperoxy)cyclohexane (PubChem CID 71658725) has the molecular formula C30H60O4
and a molecular weight of 484.81 g/mol. Its IUPAC name is 4-tert-butyl-1,1-bis(decylperoxy)cyclohexane.
Molecular Properties
| Compound Name | 4-tert-butyl-1,1-bis(decylperoxy)cyclohexane |
| PubChem CID | 71658725 |
| Molecular Formula | C30H60O4 |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 484.45 |
| IUPAC Name | 4-tert-butyl-1,1-bis(decylperoxy)cyclohexane |
| SMILES | CCCCCCCCCCOOC1(OOCCCCCCCCCC)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C30H60O4/c1-6-8-10-12-14-16-18-20-26-31-33-30(24-22-28(23-25-30)29(3,4)5)34-32-27-21-19-17-15-13-11-9-7-2/h28H,6-27H2,1-5H3 |
| InChIKey | CHLWGHOMDZROFQ-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-1,1-bis(decylperoxy)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1,1-bis(decylperoxy)cyclohexane?
The IUPAC name of 4-tert-butyl-1,1-bis(decylperoxy)cyclohexane (CID 71658725) is 4-tert-butyl-1,1-bis(decylperoxy)cyclohexane.
What is the SMILES notation for 4-tert-butyl-1,1-bis(decylperoxy)cyclohexane?
The canonical SMILES for 4-tert-butyl-1,1-bis(decylperoxy)cyclohexane is CCCCCCCCCCOOC1(OOCCCCCCCCCC)CCC(C(C)(C)C)CC1.
What is the InChIKey of 4-tert-butyl-1,1-bis(decylperoxy)cyclohexane?
The InChIKey is CHLWGHOMDZROFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H60O4/c1-6-8-10-12-14-16-18-20-26-31-33-30(24-22-28(23-25-30)29(3,4)5)34-32-27-21-19-17-15-13-11-9-7-2/h28H,6-27H2,1-5H3.
What are the key properties of 4-tert-butyl-1,1-bis(decylperoxy)cyclohexane?
4-tert-butyl-1,1-bis(decylperoxy)cyclohexane has a molecular weight of 484.81 g/mol, XLogP of 10.10, 22 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1,1-bis(decylperoxy)cyclohexane is sourced from PubChem (CID 71658725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).