About 7-chloro-4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline
7-chloro-4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline (PubChem CID 71658756) has the molecular formula C19H16Cl3N3O2S
and a molecular weight of 456.78 g/mol. Its IUPAC name is 7-chloro-4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline.
Molecular Properties
| Compound Name | 7-chloro-4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline |
| PubChem CID | 71658756 |
| Molecular Formula | C19H16Cl3N3O2S |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | 7-chloro-4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline |
| SMILES | O=S(=O)(c1cc(Cl)ccc1Cl)N1CCN(c2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C19H16Cl3N3O2S/c20-13-1-3-15-17(11-13)23-6-5-18(15)24-7-9-25(10-8-24)28(26,27)19-12-14(21)2-4-16(19)22/h1-6,11-12H,7-10H2 |
| InChIKey | CLVMMCXYGIYZKH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline?
The IUPAC name of 7-chloro-4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline (CID 71658756) is 7-chloro-4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline.
What is the SMILES notation for 7-chloro-4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline?
The canonical SMILES for 7-chloro-4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline is O=S(=O)(c1cc(Cl)ccc1Cl)N1CCN(c2ccnc3cc(Cl)ccc23)CC1.
What is the InChIKey of 7-chloro-4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline?
The InChIKey is CLVMMCXYGIYZKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16Cl3N3O2S/c20-13-1-3-15-17(11-13)23-6-5-18(15)24-7-9-25(10-8-24)28(26,27)19-12-14(21)2-4-16(19)22/h1-6,11-12H,7-10H2.
What are the key properties of 7-chloro-4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline?
7-chloro-4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline has a molecular weight of 456.78 g/mol, XLogP of 4.71, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]quinoline is sourced from PubChem (CID 71658756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).