C34H57NO5Si2 — CID 71658905
(3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-N,3-dimethoxy-N,6,6-trimethylheptanamide (PubChem CID 71658905) has the molecular formula C34H57NO5Si2 and a molecular weight of 616.00 g/mol. Its IUPAC name is (3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-N,3-dimethoxy-N,6,6-trimethylheptanamide.
| Compound Name | (3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-N,3-dimethoxy-N,6,6-trimethylheptanamide |
|---|---|
| PubChem CID | 71658905 |
| Molecular Formula | C34H57NO5Si2 |
| Molecular Weight | 616.00 g/mol |
| Exact Mass | 615.38 |
| IUPAC Name | (3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-N,3-dimethoxy-N,6,6-trimethylheptanamide |
| SMILES | CO[C@H](CC(=O)N(C)OC)C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H57NO5Si2/c1-32(2,3)41(12,13)40-30(24-27(37-10)25-31(36)35(9)38-11)34(7,8)26-39-42(33(4,5)6,28-20-16-14-17-21-28)29-22-18-15-19-23-29/h14-23,27,30H,24-26H2,1-13H3/t27-,30-/m0/s1 |
| InChIKey | FTZKSBUZRIHGKQ-FIBWVYCGSA-N |
| XLogP | 6.79 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.00 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|