C28H43NO5Si — CID 71658910
(3S,5S)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-N,3-dimethoxy-N,6,6-trimethylheptanamide (PubChem CID 71658910) has the molecular formula C28H43NO5Si and a molecular weight of 501.74 g/mol. Its IUPAC name is (3S,5S)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-N,3-dimethoxy-N,6,6-trimethylheptanamide.
| Compound Name | (3S,5S)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-N,3-dimethoxy-N,6,6-trimethylheptanamide |
|---|---|
| PubChem CID | 71658910 |
| Molecular Formula | C28H43NO5Si |
| Molecular Weight | 501.74 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | (3S,5S)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-N,3-dimethoxy-N,6,6-trimethylheptanamide |
| SMILES | CO[C@H](CC(=O)N(C)OC)C[C@H](O)C(C)(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H43NO5Si/c1-27(2,3)35(23-15-11-9-12-16-23,24-17-13-10-14-18-24)34-21-28(4,5)25(30)19-22(32-7)20-26(31)29(6)33-8/h9-18,22,25,30H,19-21H2,1-8H3/t22-,25-/m0/s1 |
| InChIKey | BALVQPHAMVYIRE-DHLKQENFSA-N |
| XLogP | 3.77 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.74 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|