C12H16O4 — CID 71658959
(3aR,7S,7aR)-7-hydroxy-2,2-dimethyl-7a-prop-2-enyl-3a,7-dihydro-1,3-benzodioxol-4-one (PubChem CID 71658959) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (3aR,7S,7aR)-7-hydroxy-2,2-dimethyl-7a-prop-2-enyl-3a,7-dihydro-1,3-benzodioxol-4-one.
| Compound Name | (3aR,7S,7aR)-7-hydroxy-2,2-dimethyl-7a-prop-2-enyl-3a,7-dihydro-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 71658959 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (3aR,7S,7aR)-7-hydroxy-2,2-dimethyl-7a-prop-2-enyl-3a,7-dihydro-1,3-benzodioxol-4-one |
| SMILES | C=CC[C@]12OC(C)(C)O[C@H]1C(=O)C=C[C@@H]2O |
| InChI | InChI=1S/C12H16O4/c1-4-7-12-9(14)6-5-8(13)10(12)15-11(2,3)16-12/h4-6,9-10,14H,1,7H2,2-3H3/t9-,10-,12+/m0/s1 |
| InChIKey | KGMXYZOEGPQPOC-JBLDHEPKSA-N |
| XLogP | 0.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|