C42H72O4SSi2 — CID 71659028
S-decyl (3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-6,6-dimethylheptanethioate (PubChem CID 71659028) has the molecular formula C42H72O4SSi2 and a molecular weight of 729.27 g/mol. Its IUPAC name is S-decyl (3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-6,6-dimethylheptanethioate.
| Compound Name | S-decyl (3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-6,6-dimethylheptanethioate |
|---|---|
| PubChem CID | 71659028 |
| Molecular Formula | C42H72O4SSi2 |
| Molecular Weight | 729.27 g/mol |
| Exact Mass | 728.47 |
| IUPAC Name | S-decyl (3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-6,6-dimethylheptanethioate |
| SMILES | CCCCCCCCCCSC(=O)C[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC |
| InChI | InChI=1S/C42H72O4SSi2/c1-13-14-15-16-17-18-19-26-31-47-39(43)33-35(44-10)32-38(46-48(11,12)40(2,3)4)42(8,9)34-45-49(41(5,6)7,36-27-22-20-23-28-36)37-29-24-21-25-30-37/h20-25,27-30,35,38H,13-19,26,31-34H2,1-12H3/t35-,38-/m0/s1 |
| InChIKey | LEOFAESHWBBKKB-LFGICVIVSA-N |
| XLogP | 11.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.27 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|