C42H47NO3S — CID 71659090
CID 71659090 (PubChem CID 71659090) has the molecular formula C42H47NO3S and a molecular weight of 645.91 g/mol.
| Compound Name | CID 71659090 |
|---|---|
| PubChem CID | 71659090 |
| Molecular Formula | C42H47NO3S |
| Molecular Weight | 645.91 g/mol |
| Exact Mass | 645.33 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1[C@H]1[C@@H]2CSCN2[C@@]2(C(=O)c3cccc4cccc2c34)[C@@]12C[C@H]1[C@@H]3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]1(C)C2=O |
| InChI | InChI=1S/C42H47NO3S/c1-24-8-4-5-11-28(24)36-34-22-47-23-43(34)42(32-13-7-10-25-9-6-12-30(35(25)32)37(42)45)41(36)21-33-29-15-14-26-20-27(44)16-18-39(26,2)31(29)17-19-40(33,3)38(41)46/h4-13,26-27,29,31,33-34,36,44H,14-23H2,1-3H3/t26-,27-,29+,31-,33-,34-,36-,39-,40-,41-,42-/m0/s1 |
| InChIKey | LSGNAXOOKWGAQK-NSKSNBIZSA-N |
| XLogP | 8.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.91 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |