C27H21F3N2O3 — CID 71659926
(3S,3aS,6aR)-5-benzyl-2-phenyl-3-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 71659926) has the molecular formula C27H21F3N2O3 and a molecular weight of 478.47 g/mol. Its IUPAC name is (3S,3aS,6aR)-5-benzyl-2-phenyl-3-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aS,6aR)-5-benzyl-2-phenyl-3-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 71659926 |
| Molecular Formula | C27H21F3N2O3 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | (3S,3aS,6aR)-5-benzyl-2-phenyl-3-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1[C@@H]2[C@@H](ON(c3ccccc3)[C@H]2/C=C/c2ccc(C(F)(F)F)cc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C27H21F3N2O3/c28-27(29,30)20-14-11-18(12-15-20)13-16-22-23-24(35-32(22)21-9-5-2-6-10-21)26(34)31(25(23)33)17-19-7-3-1-4-8-19/h1-16,22-24H,17H2/b16-13+/t22-,23-,24+/m0/s1 |
| InChIKey | PERYVPWKLKAADV-QCTPNZLMSA-N |
| XLogP | 5.09 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|