About N-benzyl-1-butyl-2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide
N-benzyl-1-butyl-2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide (PubChem CID 71660060) has the molecular formula C20H24N2O2
and a molecular weight of 324.42 g/mol. Its IUPAC name is N-benzyl-1-butyl-2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-1-butyl-2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide |
| PubChem CID | 71660060 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N-benzyl-1-butyl-2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide |
| SMILES | CCCCn1c2c(cc(C(=O)NCc3ccccc3)c1=O)CCC2 |
| InChI | InChI=1S/C20H24N2O2/c1-2-3-12-22-18-11-7-10-16(18)13-17(20(22)24)19(23)21-14-15-8-5-4-6-9-15/h4-6,8-9,13H,2-3,7,10-12,14H2,1H3,(H,21,23) |
| InChIKey | RETSFECQNLSYQB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-1-butyl-2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-butyl-2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide?
The IUPAC name of N-benzyl-1-butyl-2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide (CID 71660060) is N-benzyl-1-butyl-2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide.
What is the SMILES notation for N-benzyl-1-butyl-2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide?
The canonical SMILES for N-benzyl-1-butyl-2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide is CCCCn1c2c(cc(C(=O)NCc3ccccc3)c1=O)CCC2.
What is the InChIKey of N-benzyl-1-butyl-2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide?
The InChIKey is RETSFECQNLSYQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O2/c1-2-3-12-22-18-11-7-10-16(18)13-17(20(22)24)19(23)21-14-15-8-5-4-6-9-15/h4-6,8-9,13H,2-3,7,10-12,14H2,1H3,(H,21,23).
What are the key properties of N-benzyl-1-butyl-2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide?
N-benzyl-1-butyl-2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide has a molecular weight of 324.42 g/mol, XLogP of 3.07, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-butyl-2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide is sourced from PubChem (CID 71660060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).