C17H22N2O3S — CID 71660102
N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzenesulfonamide (PubChem CID 71660102) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzenesulfonamide.
| Compound Name | N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71660102 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzenesulfonamide |
| SMILES | CCCCn1c(C)c(C)cc(NS(=O)(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C17H22N2O3S/c1-4-5-11-19-14(3)13(2)12-16(17(19)20)18-23(21,22)15-9-7-6-8-10-15/h6-10,12,18H,4-5,11H2,1-3H3 |
| InChIKey | XYVWKLJMYBUTNJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |