C22H28N2O3 — CID 71660104
N-benzyl-1-(2-methoxyethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide (PubChem CID 71660104) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-benzyl-1-(2-methoxyethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide.
| Compound Name | N-benzyl-1-(2-methoxyethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71660104 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N-benzyl-1-(2-methoxyethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
| SMILES | COCCn1c2c(cc(C(=O)NCc3ccccc3)c1=O)CCCCCC2 |
| InChI | InChI=1S/C22H28N2O3/c1-27-14-13-24-20-12-8-3-2-7-11-18(20)15-19(22(24)26)21(25)23-16-17-9-5-4-6-10-17/h4-6,9-10,15H,2-3,7-8,11-14,16H2,1H3,(H,23,25) |
| InChIKey | PIIJIDXGYZBGMW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |