C25H36N4 — CID 71660284
(2S)-2-N-[2-(4-phenylpiperazin-1-yl)ethyl]-2-N-propyl-1,2,3,4-tetrahydronaphthalene-2,7-diamine (PubChem CID 71660284) has the molecular formula C25H36N4 and a molecular weight of 392.59 g/mol. Its IUPAC name is (2S)-2-N-[2-(4-phenylpiperazin-1-yl)ethyl]-2-N-propyl-1,2,3,4-tetrahydronaphthalene-2,7-diamine.
| Compound Name | (2S)-2-N-[2-(4-phenylpiperazin-1-yl)ethyl]-2-N-propyl-1,2,3,4-tetrahydronaphthalene-2,7-diamine |
|---|---|
| PubChem CID | 71660284 |
| Molecular Formula | C25H36N4 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | (2S)-2-N-[2-(4-phenylpiperazin-1-yl)ethyl]-2-N-propyl-1,2,3,4-tetrahydronaphthalene-2,7-diamine |
| SMILES | CCCN(CCN1CCN(c2ccccc2)CC1)[C@H]1CCc2ccc(N)cc2C1 |
| InChI | InChI=1S/C25H36N4/c1-2-12-28(25-11-9-21-8-10-23(26)19-22(21)20-25)16-13-27-14-17-29(18-15-27)24-6-4-3-5-7-24/h3-8,10,19,25H,2,9,11-18,20,26H2,1H3/t25-/m0/s1 |
| InChIKey | FJXRWQLSUYHSFX-VWLOTQADSA-N |
| XLogP | 3.66 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|