C15H15F3N4OS2 — CID 71660294
2-(2-butylsulfanyl-6-fluoro-1,3-benzothiazol-5-yl)-4-(difluoromethyl)-5-methyl-1,2,4-triazol-3-one (PubChem CID 71660294) has the molecular formula C15H15F3N4OS2 and a molecular weight of 388.44 g/mol. Its IUPAC name is 2-(2-butylsulfanyl-6-fluoro-1,3-benzothiazol-5-yl)-4-(difluoromethyl)-5-methyl-1,2,4-triazol-3-one.
| Compound Name | 2-(2-butylsulfanyl-6-fluoro-1,3-benzothiazol-5-yl)-4-(difluoromethyl)-5-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 71660294 |
| Molecular Formula | C15H15F3N4OS2 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 2-(2-butylsulfanyl-6-fluoro-1,3-benzothiazol-5-yl)-4-(difluoromethyl)-5-methyl-1,2,4-triazol-3-one |
| SMILES | CCCCSc1nc2cc(-n3nc(C)n(C(F)F)c3=O)c(F)cc2s1 |
| InChI | InChI=1S/C15H15F3N4OS2/c1-3-4-5-24-14-19-10-7-11(9(16)6-12(10)25-14)22-15(23)21(13(17)18)8(2)20-22/h6-7,13H,3-5H2,1-2H3 |
| InChIKey | YTTCDIQBJDTVMB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|