C27H31N3O3 — CID 71660508
6-N,8-N-bis[(1R)-1-phenylpropyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide (PubChem CID 71660508) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is 6-N,8-N-bis[(1R)-1-phenylpropyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide.
| Compound Name | 6-N,8-N-bis[(1R)-1-phenylpropyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide |
|---|---|
| PubChem CID | 71660508 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 6-N,8-N-bis[(1R)-1-phenylpropyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide |
| SMILES | CC[C@@H](NC(=O)c1cc(C(=O)N[C@H](CC)c2ccccc2)n2c1COCC2)c1ccccc1 |
| InChI | InChI=1S/C27H31N3O3/c1-3-22(19-11-7-5-8-12-19)28-26(31)21-17-24(30-15-16-33-18-25(21)30)27(32)29-23(4-2)20-13-9-6-10-14-20/h5-14,17,22-23H,3-4,15-16,18H2,1-2H3,(H,28,31)(H,29,32)/t22-,23-/m1/s1 |
| InChIKey | OIAHOHDKGALLJK-DHIUTWEWSA-N |
| XLogP | 4.78 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |