About 4-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)butan-2-one
4-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)butan-2-one (PubChem CID 71661449) has the molecular formula C19H21NO
and a molecular weight of 279.38 g/mol. Its IUPAC name is 4-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)butan-2-one.
Molecular Properties
| Compound Name | 4-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)butan-2-one |
| PubChem CID | 71661449 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 4-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)butan-2-one |
| SMILES | CC(=O)CCC1c2ccccc2CCN1c1ccccc1 |
| InChI | InChI=1S/C19H21NO/c1-15(21)11-12-19-18-10-6-5-7-16(18)13-14-20(19)17-8-3-2-4-9-17/h2-10,19H,11-14H2,1H3 |
| InChIKey | WOHJEUVEPWZYQK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)butan-2-one?
The IUPAC name of 4-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)butan-2-one (CID 71661449) is 4-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)butan-2-one.
What is the SMILES notation for 4-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)butan-2-one?
The canonical SMILES for 4-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)butan-2-one is CC(=O)CCC1c2ccccc2CCN1c1ccccc1.
What is the InChIKey of 4-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)butan-2-one?
The InChIKey is WOHJEUVEPWZYQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO/c1-15(21)11-12-19-18-10-6-5-7-16(18)13-14-20(19)17-8-3-2-4-9-17/h2-10,19H,11-14H2,1H3.
What are the key properties of 4-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)butan-2-one?
4-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)butan-2-one has a molecular weight of 279.38 g/mol, XLogP of 4.16, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)butan-2-one is sourced from PubChem (CID 71661449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).