C25H37NO6 — CID 71661672
tert-butyl (2R)-2-[(3aS,4S,8Z,9aS)-5-[(1R)-1-(4-methoxyphenyl)ethyl]-2,2-dimethyl-4,6,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]azocin-4-yl]-2-hydroxyacetate (PubChem CID 71661672) has the molecular formula C25H37NO6 and a molecular weight of 447.57 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(3aS,4S,8Z,9aS)-5-[(1R)-1-(4-methoxyphenyl)ethyl]-2,2-dimethyl-4,6,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]azocin-4-yl]-2-hydroxyacetate.
| Compound Name | tert-butyl (2R)-2-[(3aS,4S,8Z,9aS)-5-[(1R)-1-(4-methoxyphenyl)ethyl]-2,2-dimethyl-4,6,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]azocin-4-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 71661672 |
| Molecular Formula | C25H37NO6 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | tert-butyl (2R)-2-[(3aS,4S,8Z,9aS)-5-[(1R)-1-(4-methoxyphenyl)ethyl]-2,2-dimethyl-4,6,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]azocin-4-yl]-2-hydroxyacetate |
| SMILES | COc1ccc([C@@H](C)N2CC/C=C\[C@@H]3OC(C)(C)O[C@H]3[C@@H]2[C@@H](O)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H37NO6/c1-16(17-11-13-18(29-7)14-12-17)26-15-9-8-10-19-22(31-25(5,6)30-19)20(26)21(27)23(28)32-24(2,3)4/h8,10-14,16,19-22,27H,9,15H2,1-7H3/b10-8-/t16-,19+,20+,21-,22-/m1/s1 |
| InChIKey | WPYXDJXHCDPPCT-BEDNAAINSA-N |
| XLogP | 3.61 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|