About N-[2-(1H-indol-2-yl)-5,8-dioxoquinolin-7-yl]acetamide
N-[2-(1H-indol-2-yl)-5,8-dioxoquinolin-7-yl]acetamide (PubChem CID 71661701) has the molecular formula C19H13N3O3
and a molecular weight of 331.33 g/mol. Its IUPAC name is N-[2-(1H-indol-2-yl)-5,8-dioxoquinolin-7-yl]acetamide.
Molecular Properties
| Compound Name | N-[2-(1H-indol-2-yl)-5,8-dioxoquinolin-7-yl]acetamide |
| PubChem CID | 71661701 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[2-(1H-indol-2-yl)-5,8-dioxoquinolin-7-yl]acetamide |
| SMILES | CC(=O)NC1=CC(=O)c2ccc(-c3cc4ccccc4[nH]3)nc2C1=O |
| InChI | InChI=1S/C19H13N3O3/c1-10(23)20-16-9-17(24)12-6-7-14(22-18(12)19(16)25)15-8-11-4-2-3-5-13(11)21-15/h2-9,21H,1H3,(H,20,23) |
| InChIKey | XDNOCYZBEOQLKY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1H-indol-2-yl)-5,8-dioxoquinolin-7-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1H-indol-2-yl)-5,8-dioxoquinolin-7-yl]acetamide?
The IUPAC name of N-[2-(1H-indol-2-yl)-5,8-dioxoquinolin-7-yl]acetamide (CID 71661701) is N-[2-(1H-indol-2-yl)-5,8-dioxoquinolin-7-yl]acetamide.
What is the SMILES notation for N-[2-(1H-indol-2-yl)-5,8-dioxoquinolin-7-yl]acetamide?
The canonical SMILES for N-[2-(1H-indol-2-yl)-5,8-dioxoquinolin-7-yl]acetamide is CC(=O)NC1=CC(=O)c2ccc(-c3cc4ccccc4[nH]3)nc2C1=O.
What is the InChIKey of N-[2-(1H-indol-2-yl)-5,8-dioxoquinolin-7-yl]acetamide?
The InChIKey is XDNOCYZBEOQLKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13N3O3/c1-10(23)20-16-9-17(24)12-6-7-14(22-18(12)19(16)25)15-8-11-4-2-3-5-13(11)21-15/h2-9,21H,1H3,(H,20,23).
What are the key properties of N-[2-(1H-indol-2-yl)-5,8-dioxoquinolin-7-yl]acetamide?
N-[2-(1H-indol-2-yl)-5,8-dioxoquinolin-7-yl]acetamide has a molecular weight of 331.33 g/mol, XLogP of 2.63, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1H-indol-2-yl)-5,8-dioxoquinolin-7-yl]acetamide is sourced from PubChem (CID 71661701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).