About 7-amino-2-pyridin-3-ylquinoline-5,8-dione
7-amino-2-pyridin-3-ylquinoline-5,8-dione (PubChem CID 71661704) has the molecular formula C14H9N3O2
and a molecular weight of 251.25 g/mol. Its IUPAC name is 7-amino-2-pyridin-3-ylquinoline-5,8-dione.
Molecular Properties
| Compound Name | 7-amino-2-pyridin-3-ylquinoline-5,8-dione |
| PubChem CID | 71661704 |
| Molecular Formula | C14H9N3O2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 7-amino-2-pyridin-3-ylquinoline-5,8-dione |
| SMILES | NC1=CC(=O)c2ccc(-c3cccnc3)nc2C1=O |
| InChI | InChI=1S/C14H9N3O2/c15-10-6-12(18)9-3-4-11(17-13(9)14(10)19)8-2-1-5-16-7-8/h1-7H,15H2 |
| InChIKey | GVPXDFWHSPTNIW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-2-pyridin-3-ylquinoline-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-2-pyridin-3-ylquinoline-5,8-dione?
The IUPAC name of 7-amino-2-pyridin-3-ylquinoline-5,8-dione (CID 71661704) is 7-amino-2-pyridin-3-ylquinoline-5,8-dione.
What is the SMILES notation for 7-amino-2-pyridin-3-ylquinoline-5,8-dione?
The canonical SMILES for 7-amino-2-pyridin-3-ylquinoline-5,8-dione is NC1=CC(=O)c2ccc(-c3cccnc3)nc2C1=O.
What is the InChIKey of 7-amino-2-pyridin-3-ylquinoline-5,8-dione?
The InChIKey is GVPXDFWHSPTNIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O2/c15-10-6-12(18)9-3-4-11(17-13(9)14(10)19)8-2-1-5-16-7-8/h1-7H,15H2.
What are the key properties of 7-amino-2-pyridin-3-ylquinoline-5,8-dione?
7-amino-2-pyridin-3-ylquinoline-5,8-dione has a molecular weight of 251.25 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-2-pyridin-3-ylquinoline-5,8-dione is sourced from PubChem (CID 71661704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).