C26H46O7 — CID 71661983
(1S,4S,6R,7R,10S,12R,14E,18S)-10-(hydroxymethyl)-6-(methoxymethoxy)-4,7,12,20,20-pentamethyl-9,19,21-trioxabicyclo[16.3.0]henicos-14-en-8-one (PubChem CID 71661983) has the molecular formula C26H46O7 and a molecular weight of 470.65 g/mol. Its IUPAC name is (1S,4S,6R,7R,10S,12R,14E,18S)-10-(hydroxymethyl)-6-(methoxymethoxy)-4,7,12,20,20-pentamethyl-9,19,21-trioxabicyclo[16.3.0]henicos-14-en-8-one.
| Compound Name | (1S,4S,6R,7R,10S,12R,14E,18S)-10-(hydroxymethyl)-6-(methoxymethoxy)-4,7,12,20,20-pentamethyl-9,19,21-trioxabicyclo[16.3.0]henicos-14-en-8-one |
|---|---|
| PubChem CID | 71661983 |
| Molecular Formula | C26H46O7 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | (1S,4S,6R,7R,10S,12R,14E,18S)-10-(hydroxymethyl)-6-(methoxymethoxy)-4,7,12,20,20-pentamethyl-9,19,21-trioxabicyclo[16.3.0]henicos-14-en-8-one |
| SMILES | COCO[C@@H]1C[C@@H](C)CC[C@@H]2OC(C)(C)O[C@H]2CC/C=C/C[C@@H](C)C[C@@H](CO)OC(=O)[C@@H]1C |
| InChI | InChI=1S/C26H46O7/c1-18-10-8-7-9-11-22-23(33-26(4,5)32-22)13-12-19(2)15-24(30-17-29-6)20(3)25(28)31-21(14-18)16-27/h7-8,18-24,27H,9-17H2,1-6H3/b8-7+/t18-,19+,20-,21+,22+,23+,24-/m1/s1 |
| InChIKey | BNNYGEILRWVDBJ-UTYRPBAJSA-N |
| XLogP | 4.61 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|