About 1,1-dibromo-3-diethoxyphosphoryl-3,3-difluoroprop-1-ene
1,1-dibromo-3-diethoxyphosphoryl-3,3-difluoroprop-1-ene (PubChem CID 71662166) has the molecular formula C7H11Br2F2O3P
and a molecular weight of 371.94 g/mol. Its IUPAC name is 1,1-dibromo-3-diethoxyphosphoryl-3,3-difluoroprop-1-ene.
Molecular Properties
| Compound Name | 1,1-dibromo-3-diethoxyphosphoryl-3,3-difluoroprop-1-ene |
| PubChem CID | 71662166 |
| Molecular Formula | C7H11Br2F2O3P |
| Molecular Weight | 371.94 g/mol |
| Exact Mass | 369.88 |
| IUPAC Name | 1,1-dibromo-3-diethoxyphosphoryl-3,3-difluoroprop-1-ene |
| SMILES | CCOP(=O)(OCC)C(F)(F)C=C(Br)Br |
| InChI | InChI=1S/C7H11Br2F2O3P/c1-3-13-15(12,14-4-2)7(10,11)5-6(8)9/h5H,3-4H2,1-2H3 |
| InChIKey | YTLVTCYWLTWCSX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.94 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dibromo-3-diethoxyphosphoryl-3,3-difluoroprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibromo-3-diethoxyphosphoryl-3,3-difluoroprop-1-ene?
The IUPAC name of 1,1-dibromo-3-diethoxyphosphoryl-3,3-difluoroprop-1-ene (CID 71662166) is 1,1-dibromo-3-diethoxyphosphoryl-3,3-difluoroprop-1-ene.
What is the SMILES notation for 1,1-dibromo-3-diethoxyphosphoryl-3,3-difluoroprop-1-ene?
The canonical SMILES for 1,1-dibromo-3-diethoxyphosphoryl-3,3-difluoroprop-1-ene is CCOP(=O)(OCC)C(F)(F)C=C(Br)Br.
What is the InChIKey of 1,1-dibromo-3-diethoxyphosphoryl-3,3-difluoroprop-1-ene?
The InChIKey is YTLVTCYWLTWCSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11Br2F2O3P/c1-3-13-15(12,14-4-2)7(10,11)5-6(8)9/h5H,3-4H2,1-2H3.
What are the key properties of 1,1-dibromo-3-diethoxyphosphoryl-3,3-difluoroprop-1-ene?
1,1-dibromo-3-diethoxyphosphoryl-3,3-difluoroprop-1-ene has a molecular weight of 371.94 g/mol, XLogP of 4.48, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibromo-3-diethoxyphosphoryl-3,3-difluoroprop-1-ene is sourced from PubChem (CID 71662166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).