C24H32O7 — CID 71662202
4-O,4-O-diethyl 1-O-[(1R,6R)-3-methyl-4-oxo-6-prop-1-en-2-ylcyclohex-2-en-1-yl] (1E)-hepta-1,6-diene-1,4,4-tricarboxylate (PubChem CID 71662202) has the molecular formula C24H32O7 and a molecular weight of 432.51 g/mol. Its IUPAC name is 4-O,4-O-diethyl 1-O-[(1R,6R)-3-methyl-4-oxo-6-prop-1-en-2-ylcyclohex-2-en-1-yl] (1E)-hepta-1,6-diene-1,4,4-tricarboxylate.
| Compound Name | 4-O,4-O-diethyl 1-O-[(1R,6R)-3-methyl-4-oxo-6-prop-1-en-2-ylcyclohex-2-en-1-yl] (1E)-hepta-1,6-diene-1,4,4-tricarboxylate |
|---|---|
| PubChem CID | 71662202 |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 4-O,4-O-diethyl 1-O-[(1R,6R)-3-methyl-4-oxo-6-prop-1-en-2-ylcyclohex-2-en-1-yl] (1E)-hepta-1,6-diene-1,4,4-tricarboxylate |
| SMILES | C=CCC(C/C=C/C(=O)O[C@@H]1C=C(C)C(=O)C[C@@H]1C(=C)C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C24H32O7/c1-7-12-24(22(27)29-8-2,23(28)30-9-3)13-10-11-21(26)31-20-14-17(6)19(25)15-18(20)16(4)5/h7,10-11,14,18,20H,1,4,8-9,12-13,15H2,2-3,5-6H3/b11-10+/t18-,20-/m1/s1 |
| InChIKey | SPVVIMVPXWZXBU-FKDVYQRFSA-N |
| XLogP | 3.64 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|