C42H54O12P2 — CID 71662220
[hydroxy-[17-[hydroxy(phosphono)methyl]-25,26,27,28-tetrapropoxy-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl]methyl]phosphonic acid (PubChem CID 71662220) has the molecular formula C42H54O12P2 and a molecular weight of 812.83 g/mol. Its IUPAC name is [hydroxy-[17-[hydroxy(phosphono)methyl]-25,26,27,28-tetrapropoxy-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl]methyl]phosphonic acid.
| Compound Name | [hydroxy-[17-[hydroxy(phosphono)methyl]-25,26,27,28-tetrapropoxy-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 71662220 |
| Molecular Formula | C42H54O12P2 |
| Molecular Weight | 812.83 g/mol |
| Exact Mass | 812.31 |
| IUPAC Name | [hydroxy-[17-[hydroxy(phosphono)methyl]-25,26,27,28-tetrapropoxy-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl]methyl]phosphonic acid |
| SMILES | CCCOc1c2cccc1Cc1cc(C(O)P(=O)(O)O)cc(c1OCCC)Cc1cccc(c1OCCC)Cc1cc(C(O)P(=O)(O)O)cc(c1OCCC)C2 |
| InChI | InChI=1S/C42H54O12P2/c1-5-15-51-37-27-11-9-12-28(37)20-32-24-36(42(44)56(48,49)50)26-34(40(32)54-18-8-4)22-30-14-10-13-29(38(30)52-16-6-2)21-33-25-35(41(43)55(45,46)47)23-31(19-27)39(33)53-17-7-3/h9-14,23-26,41-44H,5-8,15-22H2,1-4H3,(H2,45,46,47)(H2,48,49,50) |
| InChIKey | UJCXEVICBFTIMJ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.83 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|