C29H35NO4 — CID 71662350
diethyl (Z,4S)-4-[bis(2-phenylprop-2-enyl)amino]hept-2-enedioate (PubChem CID 71662350) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is diethyl (Z,4S)-4-[bis(2-phenylprop-2-enyl)amino]hept-2-enedioate.
| Compound Name | diethyl (Z,4S)-4-[bis(2-phenylprop-2-enyl)amino]hept-2-enedioate |
|---|---|
| PubChem CID | 71662350 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | diethyl (Z,4S)-4-[bis(2-phenylprop-2-enyl)amino]hept-2-enedioate |
| SMILES | C=C(CN(CC(=C)c1ccccc1)[C@H](/C=C\C(=O)OCC)CCC(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C29H35NO4/c1-5-33-28(31)19-17-27(18-20-29(32)34-6-2)30(21-23(3)25-13-9-7-10-14-25)22-24(4)26-15-11-8-12-16-26/h7-17,19,27H,3-6,18,20-22H2,1-2H3/b19-17-/t27-/m1/s1 |
| InChIKey | APZGFRHXNCFQDA-MFUHEYGDSA-N |
| XLogP | 5.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|