About N-cycloheptyl-4,6-dimethyl-1H-indole-2-carboxamide
N-cycloheptyl-4,6-dimethyl-1H-indole-2-carboxamide (PubChem CID 71662593) has the molecular formula C18H24N2O
and a molecular weight of 284.40 g/mol. Its IUPAC name is N-cycloheptyl-4,6-dimethyl-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | N-cycloheptyl-4,6-dimethyl-1H-indole-2-carboxamide |
| PubChem CID | 71662593 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-cycloheptyl-4,6-dimethyl-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)c2cc(C(=O)NC3CCCCCC3)[nH]c2c1 |
| InChI | InChI=1S/C18H24N2O/c1-12-9-13(2)15-11-17(20-16(15)10-12)18(21)19-14-7-5-3-4-6-8-14/h9-11,14,20H,3-8H2,1-2H3,(H,19,21) |
| InChIKey | ANRDRZQBFPDAJD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cycloheptyl-4,6-dimethyl-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-4,6-dimethyl-1H-indole-2-carboxamide?
The IUPAC name of N-cycloheptyl-4,6-dimethyl-1H-indole-2-carboxamide (CID 71662593) is N-cycloheptyl-4,6-dimethyl-1H-indole-2-carboxamide.
What is the SMILES notation for N-cycloheptyl-4,6-dimethyl-1H-indole-2-carboxamide?
The canonical SMILES for N-cycloheptyl-4,6-dimethyl-1H-indole-2-carboxamide is Cc1cc(C)c2cc(C(=O)NC3CCCCCC3)[nH]c2c1.
What is the InChIKey of N-cycloheptyl-4,6-dimethyl-1H-indole-2-carboxamide?
The InChIKey is ANRDRZQBFPDAJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O/c1-12-9-13(2)15-11-17(20-16(15)10-12)18(21)19-14-7-5-3-4-6-8-14/h9-11,14,20H,3-8H2,1-2H3,(H,19,21).
What are the key properties of N-cycloheptyl-4,6-dimethyl-1H-indole-2-carboxamide?
N-cycloheptyl-4,6-dimethyl-1H-indole-2-carboxamide has a molecular weight of 284.40 g/mol, XLogP of 4.24, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-4,6-dimethyl-1H-indole-2-carboxamide is sourced from PubChem (CID 71662593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).