About N-cyclooctyl-4,6-dimethyl-1H-indole-2-carboxamide
N-cyclooctyl-4,6-dimethyl-1H-indole-2-carboxamide (PubChem CID 71662594) has the molecular formula C19H26N2O
and a molecular weight of 298.43 g/mol. Its IUPAC name is N-cyclooctyl-4,6-dimethyl-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | N-cyclooctyl-4,6-dimethyl-1H-indole-2-carboxamide |
| PubChem CID | 71662594 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N-cyclooctyl-4,6-dimethyl-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)c2cc(C(=O)NC3CCCCCCC3)[nH]c2c1 |
| InChI | InChI=1S/C19H26N2O/c1-13-10-14(2)16-12-18(21-17(16)11-13)19(22)20-15-8-6-4-3-5-7-9-15/h10-12,15,21H,3-9H2,1-2H3,(H,20,22) |
| InChIKey | YTDHMGDEWFURLB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclooctyl-4,6-dimethyl-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclooctyl-4,6-dimethyl-1H-indole-2-carboxamide?
The IUPAC name of N-cyclooctyl-4,6-dimethyl-1H-indole-2-carboxamide (CID 71662594) is N-cyclooctyl-4,6-dimethyl-1H-indole-2-carboxamide.
What is the SMILES notation for N-cyclooctyl-4,6-dimethyl-1H-indole-2-carboxamide?
The canonical SMILES for N-cyclooctyl-4,6-dimethyl-1H-indole-2-carboxamide is Cc1cc(C)c2cc(C(=O)NC3CCCCCCC3)[nH]c2c1.
What is the InChIKey of N-cyclooctyl-4,6-dimethyl-1H-indole-2-carboxamide?
The InChIKey is YTDHMGDEWFURLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O/c1-13-10-14(2)16-12-18(21-17(16)11-13)19(22)20-15-8-6-4-3-5-7-9-15/h10-12,15,21H,3-9H2,1-2H3,(H,20,22).
What are the key properties of N-cyclooctyl-4,6-dimethyl-1H-indole-2-carboxamide?
N-cyclooctyl-4,6-dimethyl-1H-indole-2-carboxamide has a molecular weight of 298.43 g/mol, XLogP of 4.63, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclooctyl-4,6-dimethyl-1H-indole-2-carboxamide is sourced from PubChem (CID 71662594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).