About 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-tert-butylbenzene
1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-tert-butylbenzene (PubChem CID 71662815) has the molecular formula C14H17F6O3P
and a molecular weight of 378.25 g/mol. Its IUPAC name is 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-tert-butylbenzene.
Molecular Properties
| Compound Name | 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-tert-butylbenzene |
| PubChem CID | 71662815 |
| Molecular Formula | C14H17F6O3P |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-tert-butylbenzene |
| SMILES | CC(C)(C)c1ccc(P(=O)(OCC(F)(F)F)OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F6O3P/c1-12(2,3)10-4-6-11(7-5-10)24(21,22-8-13(15,16)17)23-9-14(18,19)20/h4-7H,8-9H2,1-3H3 |
| InChIKey | QSIULQQJLSGEPZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-tert-butylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-tert-butylbenzene?
The IUPAC name of 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-tert-butylbenzene (CID 71662815) is 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-tert-butylbenzene.
What is the SMILES notation for 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-tert-butylbenzene?
The canonical SMILES for 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-tert-butylbenzene is CC(C)(C)c1ccc(P(=O)(OCC(F)(F)F)OCC(F)(F)F)cc1.
What is the InChIKey of 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-tert-butylbenzene?
The InChIKey is QSIULQQJLSGEPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F6O3P/c1-12(2,3)10-4-6-11(7-5-10)24(21,22-8-13(15,16)17)23-9-14(18,19)20/h4-7H,8-9H2,1-3H3.
What are the key properties of 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-tert-butylbenzene?
1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-tert-butylbenzene has a molecular weight of 378.25 g/mol, XLogP of 4.96, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-tert-butylbenzene is sourced from PubChem (CID 71662815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).