C7H7F3O — CID 71662886
(1S)-3-(trifluoromethyl)cyclohexa-2,4-dien-1-ol (PubChem CID 71662886) has the molecular formula C7H7F3O and a molecular weight of 164.13 g/mol. Its IUPAC name is (1S)-3-(trifluoromethyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | (1S)-3-(trifluoromethyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 71662886 |
| Molecular Formula | C7H7F3O |
| Molecular Weight | 164.13 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | (1S)-3-(trifluoromethyl)cyclohexa-2,4-dien-1-ol |
| SMILES | O[C@@H]1C=C(C(F)(F)F)C=CC1 |
| InChI | InChI=1S/C7H7F3O/c8-7(9,10)5-2-1-3-6(11)4-5/h1-2,4,6,11H,3H2/t6-/m0/s1 |
| InChIKey | JYTZHISBWBKXNT-LURJTMIESA-N |
| XLogP | 1.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.13 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |