About (3S,5S)-3-(2-fluorophenyl)-3-methyl-5-(trifluoromethyl)-1,2-oxazolidine
(3S,5S)-3-(2-fluorophenyl)-3-methyl-5-(trifluoromethyl)-1,2-oxazolidine (PubChem CID 71663144) has the molecular formula C11H11F4NO
and a molecular weight of 249.21 g/mol. Its IUPAC name is (3S,5S)-3-(2-fluorophenyl)-3-methyl-5-(trifluoromethyl)-1,2-oxazolidine.
Molecular Properties
| Compound Name | (3S,5S)-3-(2-fluorophenyl)-3-methyl-5-(trifluoromethyl)-1,2-oxazolidine |
| PubChem CID | 71663144 |
| Molecular Formula | C11H11F4NO |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (3S,5S)-3-(2-fluorophenyl)-3-methyl-5-(trifluoromethyl)-1,2-oxazolidine |
| SMILES | C[C@@]1(c2ccccc2F)C[C@@H](C(F)(F)F)ON1 |
| InChI | InChI=1S/C11H11F4NO/c1-10(7-4-2-3-5-8(7)12)6-9(17-16-10)11(13,14)15/h2-5,9,16H,6H2,1H3/t9-,10-/m0/s1 |
| InChIKey | GBOJLAMYZDPKAK-UWVGGRQHSA-N |
| XLogP | 2.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,5S)-3-(2-fluorophenyl)-3-methyl-5-(trifluoromethyl)-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-3-(2-fluorophenyl)-3-methyl-5-(trifluoromethyl)-1,2-oxazolidine?
The IUPAC name of (3S,5S)-3-(2-fluorophenyl)-3-methyl-5-(trifluoromethyl)-1,2-oxazolidine (CID 71663144) is (3S,5S)-3-(2-fluorophenyl)-3-methyl-5-(trifluoromethyl)-1,2-oxazolidine.
What is the SMILES notation for (3S,5S)-3-(2-fluorophenyl)-3-methyl-5-(trifluoromethyl)-1,2-oxazolidine?
The canonical SMILES for (3S,5S)-3-(2-fluorophenyl)-3-methyl-5-(trifluoromethyl)-1,2-oxazolidine is C[C@@]1(c2ccccc2F)C[C@@H](C(F)(F)F)ON1.
What is the InChIKey of (3S,5S)-3-(2-fluorophenyl)-3-methyl-5-(trifluoromethyl)-1,2-oxazolidine?
The InChIKey is GBOJLAMYZDPKAK-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H11F4NO/c1-10(7-4-2-3-5-8(7)12)6-9(17-16-10)11(13,14)15/h2-5,9,16H,6H2,1H3/t9-,10-/m0/s1.
What are the key properties of (3S,5S)-3-(2-fluorophenyl)-3-methyl-5-(trifluoromethyl)-1,2-oxazolidine?
(3S,5S)-3-(2-fluorophenyl)-3-methyl-5-(trifluoromethyl)-1,2-oxazolidine has a molecular weight of 249.21 g/mol, XLogP of 2.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-3-(2-fluorophenyl)-3-methyl-5-(trifluoromethyl)-1,2-oxazolidine is sourced from PubChem (CID 71663144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).