C24H23Br2NO — CID 71663151
(2S,3R,6S)-6-benzyl-2,3-bis(4-bromophenyl)-4-methylmorpholine (PubChem CID 71663151) has the molecular formula C24H23Br2NO and a molecular weight of 501.26 g/mol. Its IUPAC name is (2S,3R,6S)-6-benzyl-2,3-bis(4-bromophenyl)-4-methylmorpholine.
| Compound Name | (2S,3R,6S)-6-benzyl-2,3-bis(4-bromophenyl)-4-methylmorpholine |
|---|---|
| PubChem CID | 71663151 |
| Molecular Formula | C24H23Br2NO |
| Molecular Weight | 501.26 g/mol |
| Exact Mass | 499.01 |
| IUPAC Name | (2S,3R,6S)-6-benzyl-2,3-bis(4-bromophenyl)-4-methylmorpholine |
| SMILES | CN1C[C@H](Cc2ccccc2)O[C@@H](c2ccc(Br)cc2)[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H23Br2NO/c1-27-16-22(15-17-5-3-2-4-6-17)28-24(19-9-13-21(26)14-10-19)23(27)18-7-11-20(25)12-8-18/h2-14,22-24H,15-16H2,1H3/t22-,23+,24-/m0/s1 |
| InChIKey | XHMBUTLIIFQBNB-VXNXHJTFSA-N |
| XLogP | 6.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.26 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |