C18H18F6N2O — CID 71663152
N-cycloheptyl-4,6-bis(trifluoromethyl)-1H-indole-2-carboxamide (PubChem CID 71663152) has the molecular formula C18H18F6N2O and a molecular weight of 392.34 g/mol. Its IUPAC name is N-cycloheptyl-4,6-bis(trifluoromethyl)-1H-indole-2-carboxamide.
| Compound Name | N-cycloheptyl-4,6-bis(trifluoromethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 71663152 |
| Molecular Formula | C18H18F6N2O |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-cycloheptyl-4,6-bis(trifluoromethyl)-1H-indole-2-carboxamide |
| SMILES | O=C(NC1CCCCCC1)c1cc2c(C(F)(F)F)cc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C18H18F6N2O/c19-17(20,21)10-7-13(18(22,23)24)12-9-15(26-14(12)8-10)16(27)25-11-5-3-1-2-4-6-11/h7-9,11,26H,1-6H2,(H,25,27) |
| InChIKey | GYAYTRYRAAEEDC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |