C11H13F4NO — CID 71663328
(2R,4S)-4-amino-1,1,1-trifluoro-4-(2-fluorophenyl)pentan-2-ol (PubChem CID 71663328) has the molecular formula C11H13F4NO and a molecular weight of 251.22 g/mol. Its IUPAC name is (2R,4S)-4-amino-1,1,1-trifluoro-4-(2-fluorophenyl)pentan-2-ol.
| Compound Name | (2R,4S)-4-amino-1,1,1-trifluoro-4-(2-fluorophenyl)pentan-2-ol |
|---|---|
| PubChem CID | 71663328 |
| Molecular Formula | C11H13F4NO |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | (2R,4S)-4-amino-1,1,1-trifluoro-4-(2-fluorophenyl)pentan-2-ol |
| SMILES | C[C@](N)(C[C@@H](O)C(F)(F)F)c1ccccc1F |
| InChI | InChI=1S/C11H13F4NO/c1-10(16,6-9(17)11(13,14)15)7-4-2-3-5-8(7)12/h2-5,9,17H,6,16H2,1H3/t9-,10+/m1/s1 |
| InChIKey | GCYYXYSQJMNMPB-ZJUUUORDSA-N |
| XLogP | 2.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |