About N-(4-fluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine
N-(4-fluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine (PubChem CID 716634) has the molecular formula C13H9FN2O2S
and a molecular weight of 276.29 g/mol. Its IUPAC name is N-(4-fluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine |
| PubChem CID | 716634 |
| Molecular Formula | C13H9FN2O2S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | N-(4-fluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine |
| SMILES | O=S1(=O)N=C(Nc2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C13H9FN2O2S/c14-9-5-7-10(8-6-9)15-13-11-3-1-2-4-12(11)19(17,18)16-13/h1-8H,(H,15,16) |
| InChIKey | ZDUHONVYJBSSLT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-fluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine?
The IUPAC name of N-(4-fluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine (CID 716634) is N-(4-fluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine.
What is the SMILES notation for N-(4-fluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine?
The canonical SMILES for N-(4-fluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine is O=S1(=O)N=C(Nc2ccc(F)cc2)c2ccccc21.
What is the InChIKey of N-(4-fluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine?
The InChIKey is ZDUHONVYJBSSLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9FN2O2S/c14-9-5-7-10(8-6-9)15-13-11-3-1-2-4-12(11)19(17,18)16-13/h1-8H,(H,15,16).
What are the key properties of N-(4-fluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine?
N-(4-fluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine has a molecular weight of 276.29 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine is sourced from PubChem (CID 716634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).