C35H50BN3 — CID 71663425
2-tert-butyl-1-N,3-N-bis[2,6-di(propan-2-yl)phenyl]-3H-2,1-benzazaborole-1,3-diamine (PubChem CID 71663425) has the molecular formula C35H50BN3 and a molecular weight of 523.62 g/mol. Its IUPAC name is 2-tert-butyl-1-N,3-N-bis[2,6-di(propan-2-yl)phenyl]-3H-2,1-benzazaborole-1,3-diamine.
| Compound Name | 2-tert-butyl-1-N,3-N-bis[2,6-di(propan-2-yl)phenyl]-3H-2,1-benzazaborole-1,3-diamine |
|---|---|
| PubChem CID | 71663425 |
| Molecular Formula | C35H50BN3 |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.41 |
| IUPAC Name | 2-tert-butyl-1-N,3-N-bis[2,6-di(propan-2-yl)phenyl]-3H-2,1-benzazaborole-1,3-diamine |
| SMILES | CC(C)c1cccc(C(C)C)c1NB1c2ccccc2C(Nc2c(C(C)C)cccc2C(C)C)N1C(C)(C)C |
| InChI | InChI=1S/C35H50BN3/c1-22(2)26-17-14-18-27(23(3)4)32(26)37-34-30-16-12-13-21-31(30)36(39(34)35(9,10)11)38-33-28(24(5)6)19-15-20-29(33)25(7)8/h12-25,34,37-38H,1-11H3 |
| InChIKey | XIXGPCRUMULAKJ-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|