C26H31NO9 — CID 71663441
[(3aS,5R,5aR,9aS,9bS)-2,2,5a,9-tetramethyl-8-prop-2-enoxycarbonyloxy-4,5,6,7,9a,9b-hexahydro-3aH-naphtho[1,2-d][1,3]dioxol-5-yl] 4-nitrobenzoate (PubChem CID 71663441) has the molecular formula C26H31NO9 and a molecular weight of 501.53 g/mol. Its IUPAC name is [(3aS,5R,5aR,9aS,9bS)-2,2,5a,9-tetramethyl-8-prop-2-enoxycarbonyloxy-4,5,6,7,9a,9b-hexahydro-3aH-naphtho[1,2-d][1,3]dioxol-5-yl] 4-nitrobenzoate.
| Compound Name | [(3aS,5R,5aR,9aS,9bS)-2,2,5a,9-tetramethyl-8-prop-2-enoxycarbonyloxy-4,5,6,7,9a,9b-hexahydro-3aH-naphtho[1,2-d][1,3]dioxol-5-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 71663441 |
| Molecular Formula | C26H31NO9 |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | [(3aS,5R,5aR,9aS,9bS)-2,2,5a,9-tetramethyl-8-prop-2-enoxycarbonyloxy-4,5,6,7,9a,9b-hexahydro-3aH-naphtho[1,2-d][1,3]dioxol-5-yl] 4-nitrobenzoate |
| SMILES | C=CCOC(=O)OC1=C(C)[C@H]2[C@@H]3OC(C)(C)O[C@H]3C[C@@H](OC(=O)c3ccc([N+](=O)[O-])cc3)[C@]2(C)CC1 |
| InChI | InChI=1S/C26H31NO9/c1-6-13-32-24(29)33-18-11-12-26(5)20(34-23(28)16-7-9-17(10-8-16)27(30)31)14-19-22(21(26)15(18)2)36-25(3,4)35-19/h6-10,19-22H,1,11-14H2,2-5H3/t19-,20+,21-,22+,26-/m0/s1 |
| InChIKey | OLWRMDSTOSRSKK-DTUNTVCMSA-N |
| XLogP | 5.07 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|