C24H18F4O — CID 71663561
2-butyl-5-(2,3,5,6-tetrafluoro-4-naphthalen-2-ylphenyl)furan (PubChem CID 71663561) has the molecular formula C24H18F4O and a molecular weight of 398.40 g/mol. Its IUPAC name is 2-butyl-5-(2,3,5,6-tetrafluoro-4-naphthalen-2-ylphenyl)furan.
| Compound Name | 2-butyl-5-(2,3,5,6-tetrafluoro-4-naphthalen-2-ylphenyl)furan |
|---|---|
| PubChem CID | 71663561 |
| Molecular Formula | C24H18F4O |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-butyl-5-(2,3,5,6-tetrafluoro-4-naphthalen-2-ylphenyl)furan |
| SMILES | CCCCc1ccc(-c2c(F)c(F)c(-c3ccc4ccccc4c3)c(F)c2F)o1 |
| InChI | InChI=1S/C24H18F4O/c1-2-3-8-17-11-12-18(29-17)20-23(27)21(25)19(22(26)24(20)28)16-10-9-14-6-4-5-7-15(14)13-16/h4-7,9-13H,2-3,8H2,1H3 |
| InChIKey | NXWBFFJRHRCREG-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|