About 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine
1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine (PubChem CID 716638) has the molecular formula C14H9F3N2O2S
and a molecular weight of 326.30 g/mol. Its IUPAC name is 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine.
Molecular Properties
| Compound Name | 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine |
| PubChem CID | 716638 |
| Molecular Formula | C14H9F3N2O2S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine |
| SMILES | O=S1(=O)N=C(Nc2cccc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C14H9F3N2O2S/c15-14(16,17)9-4-3-5-10(8-9)18-13-11-6-1-2-7-12(11)22(20,21)19-13/h1-8H,(H,18,19) |
| InChIKey | QUTRTCPSUKCXOK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine?
The IUPAC name of 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine (CID 716638) is 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine.
What is the SMILES notation for 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine?
The canonical SMILES for 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine is O=S1(=O)N=C(Nc2cccc(C(F)(F)F)c2)c2ccccc21.
What is the InChIKey of 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine?
The InChIKey is QUTRTCPSUKCXOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F3N2O2S/c15-14(16,17)9-4-3-5-10(8-9)18-13-11-6-1-2-7-12(11)22(20,21)19-13/h1-8H,(H,18,19).
What are the key properties of 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine?
1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine has a molecular weight of 326.30 g/mol, XLogP of 3.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine is sourced from PubChem (CID 716638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).