About 3-(3-bromophenyl)-5-tert-butyl-7,7-dimethoxy-1,2-benzoxazol-7a-ol
3-(3-bromophenyl)-5-tert-butyl-7,7-dimethoxy-1,2-benzoxazol-7a-ol (PubChem CID 71663838) has the molecular formula C19H22BrNO4
and a molecular weight of 408.29 g/mol. Its IUPAC name is 3-(3-bromophenyl)-5-tert-butyl-7,7-dimethoxy-1,2-benzoxazol-7a-ol.
Molecular Properties
| Compound Name | 3-(3-bromophenyl)-5-tert-butyl-7,7-dimethoxy-1,2-benzoxazol-7a-ol |
| PubChem CID | 71663838 |
| Molecular Formula | C19H22BrNO4 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 3-(3-bromophenyl)-5-tert-butyl-7,7-dimethoxy-1,2-benzoxazol-7a-ol |
| SMILES | COC1(OC)C=C(C(C)(C)C)C=C2C(c3cccc(Br)c3)=NOC21O |
| InChI | InChI=1S/C19H22BrNO4/c1-17(2,3)13-10-15-16(12-7-6-8-14(20)9-12)21-25-19(15,22)18(11-13,23-4)24-5/h6-11,22H,1-5H3 |
| InChIKey | UEIVTALNUBZVBZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-bromophenyl)-5-tert-butyl-7,7-dimethoxy-1,2-benzoxazol-7a-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromophenyl)-5-tert-butyl-7,7-dimethoxy-1,2-benzoxazol-7a-ol?
The IUPAC name of 3-(3-bromophenyl)-5-tert-butyl-7,7-dimethoxy-1,2-benzoxazol-7a-ol (CID 71663838) is 3-(3-bromophenyl)-5-tert-butyl-7,7-dimethoxy-1,2-benzoxazol-7a-ol.
What is the SMILES notation for 3-(3-bromophenyl)-5-tert-butyl-7,7-dimethoxy-1,2-benzoxazol-7a-ol?
The canonical SMILES for 3-(3-bromophenyl)-5-tert-butyl-7,7-dimethoxy-1,2-benzoxazol-7a-ol is COC1(OC)C=C(C(C)(C)C)C=C2C(c3cccc(Br)c3)=NOC21O.
What is the InChIKey of 3-(3-bromophenyl)-5-tert-butyl-7,7-dimethoxy-1,2-benzoxazol-7a-ol?
The InChIKey is UEIVTALNUBZVBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22BrNO4/c1-17(2,3)13-10-15-16(12-7-6-8-14(20)9-12)21-25-19(15,22)18(11-13,23-4)24-5/h6-11,22H,1-5H3.
What are the key properties of 3-(3-bromophenyl)-5-tert-butyl-7,7-dimethoxy-1,2-benzoxazol-7a-ol?
3-(3-bromophenyl)-5-tert-butyl-7,7-dimethoxy-1,2-benzoxazol-7a-ol has a molecular weight of 408.29 g/mol, XLogP of 3.77, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromophenyl)-5-tert-butyl-7,7-dimethoxy-1,2-benzoxazol-7a-ol is sourced from PubChem (CID 71663838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).