C19H21Cl2NO4 — CID 71663839
5-tert-butyl-3-(2,6-dichlorophenyl)-7,7-dimethoxy-1,2-benzoxazol-7a-ol (PubChem CID 71663839) has the molecular formula C19H21Cl2NO4 and a molecular weight of 398.29 g/mol. Its IUPAC name is 5-tert-butyl-3-(2,6-dichlorophenyl)-7,7-dimethoxy-1,2-benzoxazol-7a-ol.
| Compound Name | 5-tert-butyl-3-(2,6-dichlorophenyl)-7,7-dimethoxy-1,2-benzoxazol-7a-ol |
|---|---|
| PubChem CID | 71663839 |
| Molecular Formula | C19H21Cl2NO4 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 5-tert-butyl-3-(2,6-dichlorophenyl)-7,7-dimethoxy-1,2-benzoxazol-7a-ol |
| SMILES | COC1(OC)C=C(C(C)(C)C)C=C2C(c3c(Cl)cccc3Cl)=NOC21O |
| InChI | InChI=1S/C19H21Cl2NO4/c1-17(2,3)11-9-12-16(15-13(20)7-6-8-14(15)21)22-26-19(12,23)18(10-11,24-4)25-5/h6-10,23H,1-5H3 |
| InChIKey | SIXOVKXKJUNNBP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|