About methyl (E)-4-[[(2S)-2,3-diamino-3-oxopropyl]amino]-4-oxobut-2-enoate
methyl (E)-4-[[(2S)-2,3-diamino-3-oxopropyl]amino]-4-oxobut-2-enoate (PubChem CID 71664335) has the molecular formula C8H13N3O4
and a molecular weight of 215.21 g/mol. Its IUPAC name is methyl (E)-4-[[(2S)-2,3-diamino-3-oxopropyl]amino]-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-4-[[(2S)-2,3-diamino-3-oxopropyl]amino]-4-oxobut-2-enoate |
| PubChem CID | 71664335 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | methyl (E)-4-[[(2S)-2,3-diamino-3-oxopropyl]amino]-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)NC[C@H](N)C(N)=O |
| InChI | InChI=1S/C8H13N3O4/c1-15-7(13)3-2-6(12)11-4-5(9)8(10)14/h2-3,5H,4,9H2,1H3,(H2,10,14)(H,11,12)/b3-2+/t5-/m0/s1 |
| InChIKey | MHTMKUIJXROFAD-HRJJCQLASA-N |
| XLogP | -2.36 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-4-[[(2S)-2,3-diamino-3-oxopropyl]amino]-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-4-[[(2S)-2,3-diamino-3-oxopropyl]amino]-4-oxobut-2-enoate?
The IUPAC name of methyl (E)-4-[[(2S)-2,3-diamino-3-oxopropyl]amino]-4-oxobut-2-enoate (CID 71664335) is methyl (E)-4-[[(2S)-2,3-diamino-3-oxopropyl]amino]-4-oxobut-2-enoate.
What is the SMILES notation for methyl (E)-4-[[(2S)-2,3-diamino-3-oxopropyl]amino]-4-oxobut-2-enoate?
The canonical SMILES for methyl (E)-4-[[(2S)-2,3-diamino-3-oxopropyl]amino]-4-oxobut-2-enoate is COC(=O)/C=C/C(=O)NC[C@H](N)C(N)=O.
What is the InChIKey of methyl (E)-4-[[(2S)-2,3-diamino-3-oxopropyl]amino]-4-oxobut-2-enoate?
The InChIKey is MHTMKUIJXROFAD-HRJJCQLASA-N. The full InChI is InChI=1S/C8H13N3O4/c1-15-7(13)3-2-6(12)11-4-5(9)8(10)14/h2-3,5H,4,9H2,1H3,(H2,10,14)(H,11,12)/b3-2+/t5-/m0/s1.
What are the key properties of methyl (E)-4-[[(2S)-2,3-diamino-3-oxopropyl]amino]-4-oxobut-2-enoate?
methyl (E)-4-[[(2S)-2,3-diamino-3-oxopropyl]amino]-4-oxobut-2-enoate has a molecular weight of 215.21 g/mol, XLogP of -2.36, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-4-[[(2S)-2,3-diamino-3-oxopropyl]amino]-4-oxobut-2-enoate is sourced from PubChem (CID 71664335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).