C29H37ClNO3PS — CID 71664646
3-[[4-[4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)pentyl]sulfanylphenyl]methylamino]propylphosphonic acid (PubChem CID 71664646) has the molecular formula C29H37ClNO3PS and a molecular weight of 546.11 g/mol. Its IUPAC name is 3-[[4-[4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)pentyl]sulfanylphenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)pentyl]sulfanylphenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 71664646 |
| Molecular Formula | C29H37ClNO3PS |
| Molecular Weight | 546.11 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 3-[[4-[4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)pentyl]sulfanylphenyl]methylamino]propylphosphonic acid |
| SMILES | Cc1ccc(CC(CCCSc2ccc(CNCCCP(=O)(O)O)cc2)c2cccc(Cl)c2)cc1C |
| InChI | InChI=1S/C29H37ClNO3PS/c1-22-9-10-25(18-23(22)2)19-26(27-6-3-8-28(30)20-27)7-4-17-36-29-13-11-24(12-14-29)21-31-15-5-16-35(32,33)34/h3,6,8-14,18,20,26,31H,4-5,7,15-17,19,21H2,1-2H3,(H2,32,33,34) |
| InChIKey | HPFWBDIEYOHZTC-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.11 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|